C11H11Cl2F3N2O — CID 115491613
5,6-dichloro-N-(5,5,5-trifluoropentyl)pyridine-3-carboxamide (PubChem CID 115491613) has the molecular formula C11H11Cl2F3N2O and a molecular weight of 315.12 g/mol. Its IUPAC name is 5,6-dichloro-N-(5,5,5-trifluoropentyl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(5,5,5-trifluoropentyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115491613 |
| Molecular Formula | C11H11Cl2F3N2O |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 5,6-dichloro-N-(5,5,5-trifluoropentyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCCCC(F)(F)F)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2F3N2O/c12-8-5-7(6-18-9(8)13)10(19)17-4-2-1-3-11(14,15)16/h5-6H,1-4H2,(H,17,19) |
| InChIKey | DNUGGVITJBJLRE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|