C12H14Cl2N2O3 — CID 104682536
5-[(5,6-dichloropyridine-3-carbonyl)amino]-2-methylpentanoic acid (PubChem CID 104682536) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 5-[(5,6-dichloropyridine-3-carbonyl)amino]-2-methylpentanoic acid.
| Compound Name | 5-[(5,6-dichloropyridine-3-carbonyl)amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 104682536 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 5-[(5,6-dichloropyridine-3-carbonyl)amino]-2-methylpentanoic acid |
| SMILES | CC(CCCNC(=O)c1cnc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H14Cl2N2O3/c1-7(12(18)19)3-2-4-15-11(17)8-5-9(13)10(14)16-6-8/h5-7H,2-4H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | NDHUESBXERUHMC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|