C13H14F3NO3 — CID 104682373
2-methyl-5-[(3,4,5-trifluorobenzoyl)amino]pentanoic acid (PubChem CID 104682373) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-methyl-5-[(3,4,5-trifluorobenzoyl)amino]pentanoic acid.
| Compound Name | 2-methyl-5-[(3,4,5-trifluorobenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 104682373 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-methyl-5-[(3,4,5-trifluorobenzoyl)amino]pentanoic acid |
| SMILES | CC(CCCNC(=O)c1cc(F)c(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C13H14F3NO3/c1-7(13(19)20)3-2-4-17-12(18)8-5-9(14)11(16)10(15)6-8/h5-7H,2-4H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | YHRNXDDITPXEBQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|