C13H16F3NO2 — CID 103861735
3,4,5-trifluoro-N-(5-hydroxy-4-methylpentyl)benzamide (PubChem CID 103861735) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-(5-hydroxy-4-methylpentyl)benzamide.
| Compound Name | 3,4,5-trifluoro-N-(5-hydroxy-4-methylpentyl)benzamide |
|---|---|
| PubChem CID | 103861735 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3,4,5-trifluoro-N-(5-hydroxy-4-methylpentyl)benzamide |
| SMILES | CC(CO)CCCNC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H16F3NO2/c1-8(7-18)3-2-4-17-13(19)9-5-10(14)12(16)11(15)6-9/h5-6,8,18H,2-4,7H2,1H3,(H,17,19) |
| InChIKey | OZXJYNIPSZQLAL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|