C14H19F2NO2 — CID 103862391
2-(2,3-difluorophenyl)-N-(5-hydroxy-4-methylpentyl)acetamide (PubChem CID 103862391) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-N-(5-hydroxy-4-methylpentyl)acetamide.
| Compound Name | 2-(2,3-difluorophenyl)-N-(5-hydroxy-4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 103862391 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-(2,3-difluorophenyl)-N-(5-hydroxy-4-methylpentyl)acetamide |
| SMILES | CC(CO)CCCNC(=O)Cc1cccc(F)c1F |
| InChI | InChI=1S/C14H19F2NO2/c1-10(9-18)4-3-7-17-13(19)8-11-5-2-6-12(15)14(11)16/h2,5-6,10,18H,3-4,7-9H2,1H3,(H,17,19) |
| InChIKey | XQMJOESNFJCVIR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|