C14H20F2N2O — CID 106152815
N-(5-amino-4-methylpentyl)-2-(2,6-difluorophenyl)acetamide (PubChem CID 106152815) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is N-(5-amino-4-methylpentyl)-2-(2,6-difluorophenyl)acetamide.
| Compound Name | N-(5-amino-4-methylpentyl)-2-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 106152815 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-(5-amino-4-methylpentyl)-2-(2,6-difluorophenyl)acetamide |
| SMILES | CC(CN)CCCNC(=O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C14H20F2N2O/c1-10(9-17)4-3-7-18-14(19)8-11-12(15)5-2-6-13(11)16/h2,5-6,10H,3-4,7-9,17H2,1H3,(H,18,19) |
| InChIKey | AZFDLIXGCMMORW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|