C14H17ClFNO3 — CID 104682499
5-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-methylpentanoic acid (PubChem CID 104682499) has the molecular formula C14H17ClFNO3 and a molecular weight of 301.74 g/mol. Its IUPAC name is 5-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-methylpentanoic acid.
| Compound Name | 5-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 104682499 |
| Molecular Formula | C14H17ClFNO3 |
| Molecular Weight | 301.74 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-methylpentanoic acid |
| SMILES | CC(CCCNC(=O)Cc1c(F)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C14H17ClFNO3/c1-9(14(19)20)4-3-7-17-13(18)8-10-11(15)5-2-6-12(10)16/h2,5-6,9H,3-4,7-8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | SFIZDCUFKJBVEA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.74 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|