C19H22ClFN2O4 — CID 70157795
7-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-2-methylheptanoic acid (PubChem CID 70157795) has the molecular formula C19H22ClFN2O4 and a molecular weight of 396.85 g/mol. Its IUPAC name is 7-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-2-methylheptanoic acid.
| Compound Name | 7-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 70157795 |
| Molecular Formula | C19H22ClFN2O4 |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 7-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-2-methylheptanoic acid |
| SMILES | Cc1onc(-c2c(F)cccc2Cl)c1C(=O)NCCCCCC(C)C(=O)O |
| InChI | InChI=1S/C19H22ClFN2O4/c1-11(19(25)26)7-4-3-5-10-22-18(24)15-12(2)27-23-17(15)16-13(20)8-6-9-14(16)21/h6,8-9,11H,3-5,7,10H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | GLWJRWSDBKXOBZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|