C17H20ClFN4O2S — CID 9187610
1-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3-pentylthiourea (PubChem CID 9187610) has the molecular formula C17H20ClFN4O2S and a molecular weight of 398.89 g/mol. Its IUPAC name is 1-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3-pentylthiourea.
| Compound Name | 1-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9187610 |
| Molecular Formula | C17H20ClFN4O2S |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)c1c(-c2c(F)cccc2Cl)noc1C |
| InChI | InChI=1S/C17H20ClFN4O2S/c1-3-4-5-9-20-17(26)22-21-16(24)13-10(2)25-23-15(13)14-11(18)7-6-8-12(14)19/h6-8H,3-5,9H2,1-2H3,(H,21,24)(H2,20,22,26) |
| InChIKey | KCRNFQHCDZQZKF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|