C16H18ClFN4O2S — CID 9425522
1-tert-butyl-3-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]thiourea (PubChem CID 9425522) has the molecular formula C16H18ClFN4O2S and a molecular weight of 384.86 g/mol. Its IUPAC name is 1-tert-butyl-3-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 9425522 |
| Molecular Formula | C16H18ClFN4O2S |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 1-tert-butyl-3-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]thiourea |
| SMILES | Cc1onc(-c2c(F)cccc2Cl)c1C(=O)NNC(=S)NC(C)(C)C |
| InChI | InChI=1S/C16H18ClFN4O2S/c1-8-11(14(23)20-21-15(25)19-16(2,3)4)13(22-24-8)12-9(17)6-5-7-10(12)18/h5-7H,1-4H3,(H,20,23)(H2,19,21,25) |
| InChIKey | JNKXONUIASOUTM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|