C17H18ClFN4O2S — CID 9146997
1-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3-cyclopentylthiourea (PubChem CID 9146997) has the molecular formula C17H18ClFN4O2S and a molecular weight of 396.88 g/mol. Its IUPAC name is 1-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3-cyclopentylthiourea.
| Compound Name | 1-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3-cyclopentylthiourea |
|---|---|
| PubChem CID | 9146997 |
| Molecular Formula | C17H18ClFN4O2S |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1-[[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3-cyclopentylthiourea |
| SMILES | Cc1onc(-c2c(F)cccc2Cl)c1C(=O)NNC(=S)NC1CCCC1 |
| InChI | InChI=1S/C17H18ClFN4O2S/c1-9-13(15(23-25-9)14-11(18)7-4-8-12(14)19)16(24)21-22-17(26)20-10-5-2-3-6-10/h4,7-8,10H,2-3,5-6H2,1H3,(H,21,24)(H2,20,22,26) |
| InChIKey | VKEWQPGYMCRZKN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|