C18H19Cl2N3O3S — CID 108783852
methyl 5-(cyclohexylcarbamothioylamino)-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate (PubChem CID 108783852) has the molecular formula C18H19Cl2N3O3S and a molecular weight of 428.34 g/mol. Its IUPAC name is methyl 5-(cyclohexylcarbamothioylamino)-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 5-(cyclohexylcarbamothioylamino)-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 108783852 |
| Molecular Formula | C18H19Cl2N3O3S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | methyl 5-(cyclohexylcarbamothioylamino)-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c(-c2c(Cl)cccc2Cl)noc1NC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C18H19Cl2N3O3S/c1-25-17(24)14-15(13-11(19)8-5-9-12(13)20)23-26-16(14)22-18(27)21-10-6-3-2-4-7-10/h5,8-10H,2-4,6-7H2,1H3,(H2,21,22,27) |
| InChIKey | VLHCTTAGEIPWQY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|