C14H13Cl2N3O3S — CID 108783853
methyl 3-(2,6-dichlorophenyl)-5-(ethylcarbamothioylamino)-1,2-oxazole-4-carboxylate (PubChem CID 108783853) has the molecular formula C14H13Cl2N3O3S and a molecular weight of 374.25 g/mol. Its IUPAC name is methyl 3-(2,6-dichlorophenyl)-5-(ethylcarbamothioylamino)-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-(2,6-dichlorophenyl)-5-(ethylcarbamothioylamino)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 108783853 |
| Molecular Formula | C14H13Cl2N3O3S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | methyl 3-(2,6-dichlorophenyl)-5-(ethylcarbamothioylamino)-1,2-oxazole-4-carboxylate |
| SMILES | CCNC(=S)Nc1onc(-c2c(Cl)cccc2Cl)c1C(=O)OC |
| InChI | InChI=1S/C14H13Cl2N3O3S/c1-3-17-14(23)18-12-10(13(20)21-2)11(19-22-12)9-7(15)5-4-6-8(9)16/h4-6H,3H2,1-2H3,(H2,17,18,23) |
| InChIKey | MYTMNZVQHLSLNB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|