C21H16Cl2N2O5 — CID 108768569
methyl 3-(2,6-dichlorophenyl)-5-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-1,2-oxazole-4-carboxylate (PubChem CID 108768569) has the molecular formula C21H16Cl2N2O5 and a molecular weight of 447.27 g/mol. Its IUPAC name is methyl 3-(2,6-dichlorophenyl)-5-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-(2,6-dichlorophenyl)-5-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 108768569 |
| Molecular Formula | C21H16Cl2N2O5 |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | methyl 3-(2,6-dichlorophenyl)-5-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c(-c2c(Cl)cccc2Cl)noc1NC(=O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H16Cl2N2O5/c1-28-13-9-6-12(7-10-13)8-11-16(26)24-20-18(21(27)29-2)19(25-30-20)17-14(22)4-3-5-15(17)23/h3-11H,1-2H3,(H,24,26)/b11-8+ |
| InChIKey | UYRQGZJNZRUNME-DHZHZOJOSA-N |
| XLogP | 5.10 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|