About dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate
dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate (PubChem CID 2726491) has the molecular formula C13H9Cl2NO5
and a molecular weight of 330.12 g/mol. Its IUPAC name is dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate.
Analyze dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate?
The IUPAC name of dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate (CID 2726491) is dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate.
What is the SMILES notation for dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate?
The canonical SMILES for dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate is COC(=O)c1onc(-c2c(Cl)cccc2Cl)c1C(=O)OC.
What is the InChIKey of dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate?
The InChIKey is WSJYKDAFFWGRCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2NO5/c1-19-12(17)9-10(16-21-11(9)13(18)20-2)8-6(14)4-3-5-7(8)15/h3-5H,1-2H3.
What are the key properties of dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate?
dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate has a molecular weight of 330.12 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-(2,6-dichlorophenyl)-1,2-oxazole-4,5-dicarboxylate is sourced from PubChem (CID 2726491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).