C23H22Cl2N2O5 — CID 108768600
methyl 3-(2,6-dichlorophenyl)-5-[4-(2,6-dimethylphenoxy)butanoylamino]-1,2-oxazole-4-carboxylate (PubChem CID 108768600) has the molecular formula C23H22Cl2N2O5 and a molecular weight of 477.34 g/mol. Its IUPAC name is methyl 3-(2,6-dichlorophenyl)-5-[4-(2,6-dimethylphenoxy)butanoylamino]-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-(2,6-dichlorophenyl)-5-[4-(2,6-dimethylphenoxy)butanoylamino]-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 108768600 |
| Molecular Formula | C23H22Cl2N2O5 |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | methyl 3-(2,6-dichlorophenyl)-5-[4-(2,6-dimethylphenoxy)butanoylamino]-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c(-c2c(Cl)cccc2Cl)noc1NC(=O)CCCOc1c(C)cccc1C |
| InChI | InChI=1S/C23H22Cl2N2O5/c1-13-7-4-8-14(2)21(13)31-12-6-11-17(28)26-22-19(23(29)30-3)20(27-32-22)18-15(24)9-5-10-16(18)25/h4-5,7-10H,6,11-12H2,1-3H3,(H,26,28) |
| InChIKey | PYJDGTUBLQIADH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|