C21H24ClFN2O3 — CID 108541709
2-chloro-N-[2-[4-(2,6-dimethylphenoxy)butanoylamino]ethyl]-6-fluorobenzamide (PubChem CID 108541709) has the molecular formula C21H24ClFN2O3 and a molecular weight of 406.89 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-(2,6-dimethylphenoxy)butanoylamino]ethyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[2-[4-(2,6-dimethylphenoxy)butanoylamino]ethyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 108541709 |
| Molecular Formula | C21H24ClFN2O3 |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-chloro-N-[2-[4-(2,6-dimethylphenoxy)butanoylamino]ethyl]-6-fluorobenzamide |
| SMILES | Cc1cccc(C)c1OCCCC(=O)NCCNC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C21H24ClFN2O3/c1-14-6-3-7-15(2)20(14)28-13-5-10-18(26)24-11-12-25-21(27)19-16(22)8-4-9-17(19)23/h3-4,6-9H,5,10-13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | WYTOJCZXEUPCPD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|