C15H20ClFN2O2 — CID 108575170
2-chloro-N-[2-(3,3-dimethylbutanoylamino)ethyl]-6-fluorobenzamide (PubChem CID 108575170) has the molecular formula C15H20ClFN2O2 and a molecular weight of 314.79 g/mol. Its IUPAC name is 2-chloro-N-[2-(3,3-dimethylbutanoylamino)ethyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[2-(3,3-dimethylbutanoylamino)ethyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 108575170 |
| Molecular Formula | C15H20ClFN2O2 |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-chloro-N-[2-(3,3-dimethylbutanoylamino)ethyl]-6-fluorobenzamide |
| SMILES | CC(C)(C)CC(=O)NCCNC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C15H20ClFN2O2/c1-15(2,3)9-12(20)18-7-8-19-14(21)13-10(16)5-4-6-11(13)17/h4-6H,7-9H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | ZIDIELHNSBENIG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|