C10H11ClFNO2 — CID 17217215
2-chloro-6-fluoro-N-(2-methoxyethyl)benzamide (PubChem CID 17217215) has the molecular formula C10H11ClFNO2 and a molecular weight of 231.65 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-chloro-6-fluoro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 17217215 |
| Molecular Formula | C10H11ClFNO2 |
| Molecular Weight | 231.65 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-chloro-6-fluoro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C10H11ClFNO2/c1-15-6-5-13-10(14)9-7(11)3-2-4-8(9)12/h2-4H,5-6H2,1H3,(H,13,14) |
| InChIKey | CGHPQWZXGPCAII-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.65 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|