C16H14Cl2FNO2 — CID 113102839
2-chloro-N-[2-(2-chloro-5-methylphenoxy)ethyl]-6-fluorobenzamide (PubChem CID 113102839) has the molecular formula C16H14Cl2FNO2 and a molecular weight of 342.20 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-chloro-5-methylphenoxy)ethyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[2-(2-chloro-5-methylphenoxy)ethyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 113102839 |
| Molecular Formula | C16H14Cl2FNO2 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-chloro-N-[2-(2-chloro-5-methylphenoxy)ethyl]-6-fluorobenzamide |
| SMILES | Cc1ccc(Cl)c(OCCNC(=O)c2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C16H14Cl2FNO2/c1-10-5-6-11(17)14(9-10)22-8-7-20-16(21)15-12(18)3-2-4-13(15)19/h2-6,9H,7-8H2,1H3,(H,20,21) |
| InChIKey | QWBDBXPVSSVDOY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|