C19H21ClFNO2 — CID 39952297
N-[2-(4-tert-butylphenoxy)ethyl]-2-chloro-6-fluorobenzamide (PubChem CID 39952297) has the molecular formula C19H21ClFNO2 and a molecular weight of 349.83 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-2-chloro-6-fluorobenzamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-chloro-6-fluorobenzamide |
|---|---|
| PubChem CID | 39952297 |
| Molecular Formula | C19H21ClFNO2 |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-chloro-6-fluorobenzamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C19H21ClFNO2/c1-19(2,3)13-7-9-14(10-8-13)24-12-11-22-18(23)17-15(20)5-4-6-16(17)21/h4-10H,11-12H2,1-3H3,(H,22,23) |
| InChIKey | MUZYPYJXJKOZJP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|