C10H9ClFNO3 — CID 43423009
methyl 2-[(2-chloro-6-fluorobenzoyl)amino]acetate (PubChem CID 43423009) has the molecular formula C10H9ClFNO3 and a molecular weight of 245.64 g/mol. Its IUPAC name is methyl 2-[(2-chloro-6-fluorobenzoyl)amino]acetate.
| Compound Name | methyl 2-[(2-chloro-6-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 43423009 |
| Molecular Formula | C10H9ClFNO3 |
| Molecular Weight | 245.64 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | methyl 2-[(2-chloro-6-fluorobenzoyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C10H9ClFNO3/c1-16-8(14)5-13-10(15)9-6(11)3-2-4-7(9)12/h2-4H,5H2,1H3,(H,13,15) |
| InChIKey | HGFSJKVHZLZLDS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.64 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |