C11H10Cl3FN2O2 — CID 108575168
2-chloro-N-[2-[(2,2-dichloroacetyl)amino]ethyl]-6-fluorobenzamide (PubChem CID 108575168) has the molecular formula C11H10Cl3FN2O2 and a molecular weight of 327.57 g/mol. Its IUPAC name is 2-chloro-N-[2-[(2,2-dichloroacetyl)amino]ethyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[2-[(2,2-dichloroacetyl)amino]ethyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 108575168 |
| Molecular Formula | C11H10Cl3FN2O2 |
| Molecular Weight | 327.57 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 2-chloro-N-[2-[(2,2-dichloroacetyl)amino]ethyl]-6-fluorobenzamide |
| SMILES | O=C(NCCNC(=O)C(Cl)Cl)c1c(F)cccc1Cl |
| InChI | InChI=1S/C11H10Cl3FN2O2/c12-6-2-1-3-7(15)8(6)10(18)16-4-5-17-11(19)9(13)14/h1-3,9H,4-5H2,(H,16,18)(H,17,19) |
| InChIKey | UKICUTGXIQASHB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.57 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|