C20H17ClFN3O4 — CID 108540343
2-chloro-N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-6-fluorobenzamide (PubChem CID 108540343) has the molecular formula C20H17ClFN3O4 and a molecular weight of 417.82 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 108540343 |
| Molecular Formula | C20H17ClFN3O4 |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-chloro-N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]-6-fluorobenzamide |
| SMILES | CC(C(=O)NCCNC(=O)c1c(F)cccc1Cl)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H17ClFN3O4/c1-11(25-19(28)12-5-2-3-6-13(12)20(25)29)17(26)23-9-10-24-18(27)16-14(21)7-4-8-15(16)22/h2-8,11H,9-10H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | BYQLRNWNFDHCDI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|