C16H19N3O5 — CID 108540329
2-(1,3-dioxoisoindol-2-yl)-N-[2-[(2-methoxyacetyl)amino]ethyl]propanamide (PubChem CID 108540329) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[2-[(2-methoxyacetyl)amino]ethyl]propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[(2-methoxyacetyl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 108540329 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[(2-methoxyacetyl)amino]ethyl]propanamide |
| SMILES | COCC(=O)NCCNC(=O)C(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H19N3O5/c1-10(14(21)18-8-7-17-13(20)9-24-2)19-15(22)11-5-3-4-6-12(11)16(19)23/h3-6,10H,7-9H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | CXJIZRIYHLPGSN-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|