C21H21N3O5 — CID 108571870
benzyl N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]carbamate (PubChem CID 108571870) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is benzyl N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]carbamate.
| Compound Name | benzyl N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108571870 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | benzyl N-[2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl]carbamate |
| SMILES | CC(C(=O)NCCNC(=O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H21N3O5/c1-14(24-19(26)16-9-5-6-10-17(16)20(24)27)18(25)22-11-12-23-21(28)29-13-15-7-3-2-4-8-15/h2-10,14H,11-13H2,1H3,(H,22,25)(H,23,28) |
| InChIKey | NHMQHKFKAHDIHA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|