C25H28N2O6 — CID 175431597
tert-butyl 2-(1,3-dioxoisoindol-2-yl)-5-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 175431597) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is tert-butyl 2-(1,3-dioxoisoindol-2-yl)-5-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | tert-butyl 2-(1,3-dioxoisoindol-2-yl)-5-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 175431597 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | tert-butyl 2-(1,3-dioxoisoindol-2-yl)-5-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CC(C)(C)OC(=O)C(CCCNC(=O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H28N2O6/c1-25(2,3)33-23(30)20(27-21(28)18-12-7-8-13-19(18)22(27)29)14-9-15-26-24(31)32-16-17-10-5-4-6-11-17/h4-8,10-13,20H,9,14-16H2,1-3H3,(H,26,31) |
| InChIKey | FQHRVGBGTNBITR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|