C22H35N3O6 — CID 18396930
methyl (2R)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 18396930) has the molecular formula C22H35N3O6 and a molecular weight of 437.54 g/mol. Its IUPAC name is methyl (2R)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2R)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 18396930 |
| Molecular Formula | C22H35N3O6 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | methyl (2R)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@@H](CCCCNC(=O)OCc1ccccc1)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N3O6/c1-22(2,3)31-21(28)25-15-14-23-18(19(26)29-4)12-8-9-13-24-20(27)30-16-17-10-6-5-7-11-17/h5-7,10-11,18,23H,8-9,12-16H2,1-4H3,(H,24,27)(H,25,28)/t18-/m1/s1 |
| InChIKey | WOPVWZQPMJVJKR-GOSISDBHSA-N |
| XLogP | 2.74 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|