C15H21ClN2O4 — CID 170067550
methyl (2R)-2-(chloroamino)-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 170067550) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is methyl (2R)-2-(chloroamino)-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2R)-2-(chloroamino)-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 170067550 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | methyl (2R)-2-(chloroamino)-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@@H](CCCCNC(=O)OCc1ccccc1)NCl |
| InChI | InChI=1S/C15H21ClN2O4/c1-21-14(19)13(18-16)9-5-6-10-17-15(20)22-11-12-7-3-2-4-8-12/h2-4,7-8,13,18H,5-6,9-11H2,1H3,(H,17,20)/t13-/m1/s1 |
| InChIKey | TXUDDFQGJUYCII-CYBMUJFWSA-N |
| XLogP | 2.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|