C25H33N3O6 — CID 10672089
methyl (2S)-2-[[(2S)-2-amino-3-phenylmethoxypropanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 10672089) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-amino-3-phenylmethoxypropanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-amino-3-phenylmethoxypropanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 10672089 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-amino-3-phenylmethoxypropanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)[C@@H](N)COCc1ccccc1 |
| InChI | InChI=1S/C25H33N3O6/c1-32-24(30)22(28-23(29)21(26)18-33-16-19-10-4-2-5-11-19)14-8-9-15-27-25(31)34-17-20-12-6-3-7-13-20/h2-7,10-13,21-22H,8-9,14-18,26H2,1H3,(H,27,31)(H,28,29)/t21-,22-/m0/s1 |
| InChIKey | IJFYNSNZYVYYIO-VXKWHMMOSA-N |
| XLogP | 2.29 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|