C29H48N4O7 — CID 175039101
benzyl 2-[[2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 175039101) has the molecular formula C29H48N4O7 and a molecular weight of 564.72 g/mol. Its IUPAC name is benzyl 2-[[2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | benzyl 2-[[2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 175039101 |
| Molecular Formula | C29H48N4O7 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.35 |
| IUPAC Name | benzyl 2-[[2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(N)C(=O)NC(CCCCNC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H48N4O7/c1-28(2,3)39-26(36)31-18-12-10-16-22(30)24(34)33-23(25(35)38-20-21-14-8-7-9-15-21)17-11-13-19-32-27(37)40-29(4,5)6/h7-9,14-15,22-23H,10-13,16-20,30H2,1-6H3,(H,31,36)(H,32,37)(H,33,34) |
| InChIKey | KWUGOXAQMRUEQY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|