C38H48N4O9 — CID 99658315
benzyl (2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 99658315) has the molecular formula C38H48N4O9 and a molecular weight of 704.82 g/mol. Its IUPAC name is benzyl (2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | benzyl (2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 99658315 |
| Molecular Formula | C38H48N4O9 |
| Molecular Weight | 704.82 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | benzyl (2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCNC(=O)OCc1ccccc1)C(=O)N[C@H](CCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H48N4O9/c1-38(2,3)51-37(47)42-31(21-13-23-39-35(45)49-26-29-17-9-5-10-18-29)33(43)41-32(34(44)48-25-28-15-7-4-8-16-28)22-14-24-40-36(46)50-27-30-19-11-6-12-20-30/h4-12,15-20,31-32H,13-14,21-27H2,1-3H3,(H,39,45)(H,40,46)(H,41,43)(H,42,47)/t31-,32+/m0/s1 |
| InChIKey | PAVOPVZPYFZJHU-AJQTZOPKSA-N |
| XLogP | 5.52 |
| TPSA | 170.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.82 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|