C26H34F6N4O7 — CID 11388025
benzyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[(2,2,2-trifluoroacetyl)amino]pentanoyl]amino]-5-[(2,2,2-trifluoroacetyl)amino]pentanoate (PubChem CID 11388025) has the molecular formula C26H34F6N4O7 and a molecular weight of 628.57 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[(2,2,2-trifluoroacetyl)amino]pentanoyl]amino]-5-[(2,2,2-trifluoroacetyl)amino]pentanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[(2,2,2-trifluoroacetyl)amino]pentanoyl]amino]-5-[(2,2,2-trifluoroacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 11388025 |
| Molecular Formula | C26H34F6N4O7 |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[(2,2,2-trifluoroacetyl)amino]pentanoyl]amino]-5-[(2,2,2-trifluoroacetyl)amino]pentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCNC(=O)C(F)(F)F)C(=O)N[C@@H](CCCNC(=O)C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H34F6N4O7/c1-24(2,3)43-23(41)36-17(11-7-13-33-21(39)25(27,28)29)19(37)35-18(12-8-14-34-22(40)26(30,31)32)20(38)42-15-16-9-5-4-6-10-16/h4-6,9-10,17-18H,7-8,11-15H2,1-3H3,(H,33,39)(H,34,40)(H,35,37)(H,36,41)/t17-,18-/m0/s1 |
| InChIKey | OJPAXDWOXNFFKD-ROUUACIJSA-N |
| XLogP | 3.03 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|