C32H44N2O8 — CID 10886402
dibenzyl (2R,7R)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]octanedioate (PubChem CID 10886402) has the molecular formula C32H44N2O8 and a molecular weight of 584.71 g/mol. Its IUPAC name is dibenzyl (2R,7R)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]octanedioate.
| Compound Name | dibenzyl (2R,7R)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]octanedioate |
|---|---|
| PubChem CID | 10886402 |
| Molecular Formula | C32H44N2O8 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | dibenzyl (2R,7R)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]octanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCC[C@@H](NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H44N2O8/c1-31(2,3)41-29(37)33-25(27(35)39-21-23-15-9-7-10-16-23)19-13-14-20-26(34-30(38)42-32(4,5)6)28(36)40-22-24-17-11-8-12-18-24/h7-12,15-18,25-26H,13-14,19-22H2,1-6H3,(H,33,37)(H,34,38)/t25-,26-/m1/s1 |
| InChIKey | OVTRXVZICNGLJZ-CLJLJLNGSA-N |
| XLogP | 5.82 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|