C25H31NO6 — CID 15567307
1-O-benzyl 6-O-tert-butyl 2-(phenylmethoxycarbonylamino)hexanedioate (PubChem CID 15567307) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is 1-O-benzyl 6-O-tert-butyl 2-(phenylmethoxycarbonylamino)hexanedioate.
| Compound Name | 1-O-benzyl 6-O-tert-butyl 2-(phenylmethoxycarbonylamino)hexanedioate |
|---|---|
| PubChem CID | 15567307 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-O-benzyl 6-O-tert-butyl 2-(phenylmethoxycarbonylamino)hexanedioate |
| SMILES | CC(C)(C)OC(=O)CCCC(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H31NO6/c1-25(2,3)32-22(27)16-10-15-21(23(28)30-17-19-11-6-4-7-12-19)26-24(29)31-18-20-13-8-5-9-14-20/h4-9,11-14,21H,10,15-18H2,1-3H3,(H,26,29) |
| InChIKey | WJRKGMQRGWAGSE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|