C21H31NO6 — CID 67268416
8-O-tert-butyl 1-O-methyl (2S)-2-(phenylmethoxycarbonylamino)octanedioate (PubChem CID 67268416) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is 8-O-tert-butyl 1-O-methyl (2S)-2-(phenylmethoxycarbonylamino)octanedioate.
| Compound Name | 8-O-tert-butyl 1-O-methyl (2S)-2-(phenylmethoxycarbonylamino)octanedioate |
|---|---|
| PubChem CID | 67268416 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 8-O-tert-butyl 1-O-methyl (2S)-2-(phenylmethoxycarbonylamino)octanedioate |
| SMILES | COC(=O)[C@H](CCCCCC(=O)OC(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H31NO6/c1-21(2,3)28-18(23)14-10-6-9-13-17(19(24)26-4)22-20(25)27-15-16-11-7-5-8-12-16/h5,7-8,11-12,17H,6,9-10,13-15H2,1-4H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | GGKLPCAQXNZBJX-KRWDZBQOSA-N |
| XLogP | 3.75 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|