C18H29ClN2O4 — CID 67690188
tert-butyl 6-amino-2-(phenylmethoxycarbonylamino)hexanoate;hydrochloride (PubChem CID 67690188) has the molecular formula C18H29ClN2O4 and a molecular weight of 372.89 g/mol. Its IUPAC name is tert-butyl 6-amino-2-(phenylmethoxycarbonylamino)hexanoate;hydrochloride.
| Compound Name | tert-butyl 6-amino-2-(phenylmethoxycarbonylamino)hexanoate;hydrochloride |
|---|---|
| PubChem CID | 67690188 |
| Molecular Formula | C18H29ClN2O4 |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | tert-butyl 6-amino-2-(phenylmethoxycarbonylamino)hexanoate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)C(CCCCN)NC(=O)OCc1ccccc1.Cl |
| InChI | InChI=1S/C18H28N2O4.ClH/c1-18(2,3)24-16(21)15(11-7-8-12-19)20-17(22)23-13-14-9-5-4-6-10-14;/h4-6,9-10,15H,7-8,11-13,19H2,1-3H3,(H,20,22);1H |
| InChIKey | YYSNUZUKJJFPJE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|