C21H26N2O4 — CID 7408212
benzyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 7408212) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is benzyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | benzyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 7408212 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | benzyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H26N2O4/c22-14-8-7-13-19(20(24)26-15-17-9-3-1-4-10-17)23-21(25)27-16-18-11-5-2-6-12-18/h1-6,9-12,19H,7-8,13-16,22H2,(H,23,25)/t19-/m0/s1 |
| InChIKey | GCKQVXGRLKRLHJ-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|