C19H28N2O6 — CID 54361145
(2-methylpropan-2-yl)oxycarbonyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 54361145) has the molecular formula C19H28N2O6 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 54361145 |
| Molecular Formula | C19H28N2O6 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CC(C)(C)OC(=O)OC(=O)[C@H](CCCCN)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H28N2O6/c1-19(2,3)27-18(24)26-16(22)15(11-7-8-12-20)21-17(23)25-13-14-9-5-4-6-10-14/h4-6,9-10,15H,7-8,11-13,20H2,1-3H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | UMOYKJMHIRRPAB-HNNXBMFYSA-N |
| XLogP | 2.89 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|