C22H32N2O8 — CID 10742285
dimethyl (2R,6S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)heptanedioate (PubChem CID 10742285) has the molecular formula C22H32N2O8 and a molecular weight of 452.50 g/mol. Its IUPAC name is dimethyl (2R,6S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)heptanedioate.
| Compound Name | dimethyl (2R,6S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)heptanedioate |
|---|---|
| PubChem CID | 10742285 |
| Molecular Formula | C22H32N2O8 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | dimethyl (2R,6S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)heptanedioate |
| SMILES | COC(=O)[C@H](CCC[C@@H](NC(=O)OC(C)(C)C)C(=O)OC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H32N2O8/c1-22(2,3)32-21(28)24-17(19(26)30-5)13-9-12-16(18(25)29-4)23-20(27)31-14-15-10-7-6-8-11-15/h6-8,10-11,16-17H,9,12-14H2,1-5H3,(H,23,27)(H,24,28)/t16-,17+/m0/s1 |
| InChIKey | YQXZOYXVXACTRL-DLBZAZTESA-N |
| XLogP | 2.69 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|