C29H40N2O6 — CID 59750554
methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[4-[4-(phenylmethoxycarbonylamino)butyl]phenyl]pentanoate (PubChem CID 59750554) has the molecular formula C29H40N2O6 and a molecular weight of 512.65 g/mol. Its IUPAC name is methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[4-[4-(phenylmethoxycarbonylamino)butyl]phenyl]pentanoate.
| Compound Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[4-[4-(phenylmethoxycarbonylamino)butyl]phenyl]pentanoate |
|---|---|
| PubChem CID | 59750554 |
| Molecular Formula | C29H40N2O6 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[4-[4-(phenylmethoxycarbonylamino)butyl]phenyl]pentanoate |
| SMILES | COC(=O)[C@@H](CCCc1ccc(CCCCNC(=O)OCc2ccccc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H40N2O6/c1-29(2,3)37-28(34)31-25(26(32)35-4)15-10-14-23-18-16-22(17-19-23)11-8-9-20-30-27(33)36-21-24-12-6-5-7-13-24/h5-7,12-13,16-19,25H,8-11,14-15,20-21H2,1-4H3,(H,30,33)(H,31,34)/t25-/m1/s1 |
| InChIKey | GOCAZUQKNVZUMY-RUZDIDTESA-N |
| XLogP | 5.32 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|