C28H38N2O7 — CID 59750553
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-[4-(phenylmethoxycarbonylamino)butyl]phenoxy]butanoate (PubChem CID 59750553) has the molecular formula C28H38N2O7 and a molecular weight of 514.62 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-[4-(phenylmethoxycarbonylamino)butyl]phenoxy]butanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-[4-(phenylmethoxycarbonylamino)butyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 59750553 |
| Molecular Formula | C28H38N2O7 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-[4-(phenylmethoxycarbonylamino)butyl]phenoxy]butanoate |
| SMILES | COC(=O)C(CCOc1ccc(CCCCNC(=O)OCc2ccccc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H38N2O7/c1-28(2,3)37-27(33)30-24(25(31)34-4)17-19-35-23-15-13-21(14-16-23)10-8-9-18-29-26(32)36-20-22-11-6-5-7-12-22/h5-7,11-16,24H,8-10,17-20H2,1-4H3,(H,29,32)(H,30,33) |
| InChIKey | IOVLNDBSTJEMTH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|