C18H28N2O4 — CID 15286885
benzyl N-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate (PubChem CID 15286885) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is benzyl N-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate.
| Compound Name | benzyl N-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 15286885 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | benzyl N-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H28N2O4/c1-18(2,3)24-17(22)20-13-9-5-8-12-19-16(21)23-14-15-10-6-4-7-11-15/h4,6-7,10-11H,5,8-9,12-14H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | ZGJYLWJFVZLIAJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|