C19H30N2O4 — CID 59535553
tert-butyl N-[7-oxo-7-(phenylmethoxyamino)heptyl]carbamate (PubChem CID 59535553) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl N-[7-oxo-7-(phenylmethoxyamino)heptyl]carbamate.
| Compound Name | tert-butyl N-[7-oxo-7-(phenylmethoxyamino)heptyl]carbamate |
|---|---|
| PubChem CID | 59535553 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | tert-butyl N-[7-oxo-7-(phenylmethoxyamino)heptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCC(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C19H30N2O4/c1-19(2,3)25-18(23)20-14-10-5-4-9-13-17(22)21-24-15-16-11-7-6-8-12-16/h6-8,11-12H,4-5,9-10,13-15H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | LAPLZFMMLBYQBE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|