C37H61N5O9 — CID 118541021
tritert-butyl 10-[6-(phenylmethoxycarbonylamino)hexanoyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 118541021) has the molecular formula C37H61N5O9 and a molecular weight of 719.92 g/mol. Its IUPAC name is tritert-butyl 10-[6-(phenylmethoxycarbonylamino)hexanoyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | tritert-butyl 10-[6-(phenylmethoxycarbonylamino)hexanoyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 118541021 |
| Molecular Formula | C37H61N5O9 |
| Molecular Weight | 719.92 g/mol |
| Exact Mass | 719.45 |
| IUPAC Name | tritert-butyl 10-[6-(phenylmethoxycarbonylamino)hexanoyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CCCCCNC(=O)OCc2ccccc2)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C37H61N5O9/c1-35(2,3)49-32(45)40-22-20-39(30(43)18-14-11-15-19-38-31(44)48-28-29-16-12-10-13-17-29)21-23-41(33(46)50-36(4,5)6)25-27-42(26-24-40)34(47)51-37(7,8)9/h10,12-13,16-17H,11,14-15,18-28H2,1-9H3,(H,38,44) |
| InChIKey | BBLGJXAFRGYANE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.92 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|