C23H37N3O3 — CID 143444355
tert-butyl N-[6-oxo-6-[4-(2-phenylethyl)piperazin-1-yl]hexyl]carbamate (PubChem CID 143444355) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is tert-butyl N-[6-oxo-6-[4-(2-phenylethyl)piperazin-1-yl]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-oxo-6-[4-(2-phenylethyl)piperazin-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 143444355 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | tert-butyl N-[6-oxo-6-[4-(2-phenylethyl)piperazin-1-yl]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)N1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H37N3O3/c1-23(2,3)29-22(28)24-14-9-5-8-12-21(27)26-18-16-25(17-19-26)15-13-20-10-6-4-7-11-20/h4,6-7,10-11H,5,8-9,12-19H2,1-3H3,(H,24,28) |
| InChIKey | BOGBHTLMPPTYNG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|