C20H32N2O — CID 60539533
1-[4-(3,3-dimethylbutyl)piperazin-1-yl]-4-phenylbutan-1-one (PubChem CID 60539533) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-[4-(3,3-dimethylbutyl)piperazin-1-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[4-(3,3-dimethylbutyl)piperazin-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 60539533 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | 1-[4-(3,3-dimethylbutyl)piperazin-1-yl]-4-phenylbutan-1-one |
| SMILES | CC(C)(C)CCN1CCN(C(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H32N2O/c1-20(2,3)12-13-21-14-16-22(17-15-21)19(23)11-7-10-18-8-5-4-6-9-18/h4-6,8-9H,7,10-17H2,1-3H3 |
| InChIKey | MSILBBULBOYQBA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |