C20H32N2OS2 — CID 154504160
4-methyl-4-(methyldisulfanyl)-1-[4-(3-phenylpropyl)piperazin-1-yl]pentan-1-one (PubChem CID 154504160) has the molecular formula C20H32N2OS2 and a molecular weight of 380.62 g/mol. Its IUPAC name is 4-methyl-4-(methyldisulfanyl)-1-[4-(3-phenylpropyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 4-methyl-4-(methyldisulfanyl)-1-[4-(3-phenylpropyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 154504160 |
| Molecular Formula | C20H32N2OS2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 4-methyl-4-(methyldisulfanyl)-1-[4-(3-phenylpropyl)piperazin-1-yl]pentan-1-one |
| SMILES | CSSC(C)(C)CCC(=O)N1CCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H32N2OS2/c1-20(2,25-24-3)12-11-19(23)22-16-14-21(15-17-22)13-7-10-18-8-5-4-6-9-18/h4-6,8-9H,7,10-17H2,1-3H3 |
| InChIKey | KGZGHPSCNCWUOQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|