C14H26N2O3 — CID 22027804
tert-butyl N-(5-oxo-5-pyrrolidin-1-ylpentyl)carbamate (PubChem CID 22027804) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is tert-butyl N-(5-oxo-5-pyrrolidin-1-ylpentyl)carbamate.
| Compound Name | tert-butyl N-(5-oxo-5-pyrrolidin-1-ylpentyl)carbamate |
|---|---|
| PubChem CID | 22027804 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | tert-butyl N-(5-oxo-5-pyrrolidin-1-ylpentyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C14H26N2O3/c1-14(2,3)19-13(18)15-9-5-4-8-12(17)16-10-6-7-11-16/h4-11H2,1-3H3,(H,15,18) |
| InChIKey | WAJVNOZGCYFCBJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|