C14H28N2O3 — CID 162388275
tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;propane (PubChem CID 162388275) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;propane.
| Compound Name | tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;propane |
|---|---|
| PubChem CID | 162388275 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;propane |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCCC1.CCC |
| InChI | InChI=1S/C11H20N2O3.C3H8/c1-11(2,3)16-10(15)12-8-9(14)13-6-4-5-7-13;1-3-2/h4-8H2,1-3H3,(H,12,15);3H2,1-2H3 |
| InChIKey | FICWPRMHPZLXTF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |